C28H64O6P2Si4 — CID 11765041
[[(8E)-1-bis(trimethylsilyloxy)phosphoryl-9,13-dimethyltetradeca-8,12-dienyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane (PubChem CID 11765041) has the molecular formula C28H64O6P2Si4 and a molecular weight of 671.11 g/mol. Its IUPAC name is [[(8E)-1-bis(trimethylsilyloxy)phosphoryl-9,13-dimethyltetradeca-8,12-dienyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane.
| Compound Name | [[(8E)-1-bis(trimethylsilyloxy)phosphoryl-9,13-dimethyltetradeca-8,12-dienyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11765041 |
| Molecular Formula | C28H64O6P2Si4 |
| Molecular Weight | 671.11 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | [[(8E)-1-bis(trimethylsilyloxy)phosphoryl-9,13-dimethyltetradeca-8,12-dienyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/CCCCCCC(P(=O)(O[Si](C)(C)C)O[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H64O6P2Si4/c1-26(2)22-21-24-27(3)23-19-17-16-18-20-25-28(35(29,31-37(4,5)6)32-38(7,8)9)36(30,33-39(10,11)12)34-40(13,14)15/h22-23,28H,16-21,24-25H2,1-15H3/b27-23+ |
| InChIKey | CBPWNBMIQJOBDF-SLEBQGDGSA-N |
| XLogP | 12.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.11 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|