C18H34O5P2+2 — CID 57184738
[1-[formyl(oxo)phosphaniumyl]-10,14-dimethylpentadeca-9,13-dienyl]-trihydroxyphosphanium (PubChem CID 57184738) has the molecular formula C18H34O5P2+2 and a molecular weight of 392.41 g/mol. Its IUPAC name is [1-[formyl(oxo)phosphaniumyl]-10,14-dimethylpentadeca-9,13-dienyl]-trihydroxyphosphanium.
| Compound Name | [1-[formyl(oxo)phosphaniumyl]-10,14-dimethylpentadeca-9,13-dienyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 57184738 |
| Molecular Formula | C18H34O5P2+2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [1-[formyl(oxo)phosphaniumyl]-10,14-dimethylpentadeca-9,13-dienyl]-trihydroxyphosphanium |
| SMILES | CC(C)=CCCC(C)=CCCCCCCCC([P+](=O)C=O)[P+](O)(O)O |
| InChI | InChI=1S/C18H34O5P2/c1-16(2)11-10-13-17(3)12-8-6-4-5-7-9-14-18(24(20)15-19)25(21,22)23/h11-12,15,18,21-23H,4-10,13-14H2,1-3H3/q+2 |
| InChIKey | KFNDJQDNCRZGNF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|