C28H54O6P2 — CID 86750760
(6E,10E)-13,13-bis[di(propan-2-yloxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene (PubChem CID 86750760) has the molecular formula C28H54O6P2 and a molecular weight of 548.68 g/mol. Its IUPAC name is (6E,10E)-13,13-bis[di(propan-2-yloxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene.
| Compound Name | (6E,10E)-13,13-bis[di(propan-2-yloxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 86750760 |
| Molecular Formula | C28H54O6P2 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | (6E,10E)-13,13-bis[di(propan-2-yloxy)phosphoryl]-2,6,10-trimethyltrideca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(P(=O)(OC(C)C)OC(C)C)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C28H54O6P2/c1-21(2)15-13-16-26(11)17-14-18-27(12)19-20-28(35(29,31-22(3)4)32-23(5)6)36(30,33-24(7)8)34-25(9)10/h15,17,19,22-25,28H,13-14,16,18,20H2,1-12H3/b26-17+,27-19+ |
| InChIKey | BKWLXTHVMXOTSH-QRFHUDMDSA-N |
| XLogP | 10.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|