C21H42O5P2 — CID 134930416
(6E)-9-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-9-[methyl(propan-2-yloxy)phosphoryl]nona-2,6-diene (PubChem CID 134930416) has the molecular formula C21H42O5P2 and a molecular weight of 436.51 g/mol. Its IUPAC name is (6E)-9-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-9-[methyl(propan-2-yloxy)phosphoryl]nona-2,6-diene.
| Compound Name | (6E)-9-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-9-[methyl(propan-2-yloxy)phosphoryl]nona-2,6-diene |
|---|---|
| PubChem CID | 134930416 |
| Molecular Formula | C21H42O5P2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (6E)-9-di(propan-2-yloxy)phosphoryl-2,6-dimethyl-9-[methyl(propan-2-yloxy)phosphoryl]nona-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CC(P(C)(=O)OC(C)C)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C21H42O5P2/c1-16(2)12-11-13-20(9)14-15-21(27(10,22)24-17(3)4)28(23,25-18(5)6)26-19(7)8/h12,14,17-19,21H,11,13,15H2,1-10H3/b20-14+ |
| InChIKey | QLLIRWSVGKHNCD-XSFVSMFZSA-N |
| XLogP | 7.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|