C22H41O6PS — CID 54163485
1-[ethoxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid (PubChem CID 54163485) has the molecular formula C22H41O6PS and a molecular weight of 464.61 g/mol. Its IUPAC name is 1-[ethoxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid.
| Compound Name | 1-[ethoxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 54163485 |
| Molecular Formula | C22H41O6PS |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-[ethoxy(methoxymethyl)phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid |
| SMILES | CCOP(=O)(COC)C(CCCC=C(C)CCC=C(C)CCC=C(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C22H41O6PS/c1-7-28-29(23,18-27-6)22(30(24,25)26)17-9-8-13-20(4)15-11-16-21(5)14-10-12-19(2)3/h12-13,16,22H,7-11,14-15,17-18H2,1-6H3,(H,24,25,26) |
| InChIKey | OQAULYRWUGAJJW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|