C19H35O6PS — CID 100914126
(5E,9E,13E)-6,10,14-trimethyl-1-phosphonohexadeca-5,9,13-triene-1-sulfonic acid (PubChem CID 100914126) has the molecular formula C19H35O6PS and a molecular weight of 422.52 g/mol. Its IUPAC name is (5E,9E,13E)-6,10,14-trimethyl-1-phosphonohexadeca-5,9,13-triene-1-sulfonic acid.
| Compound Name | (5E,9E,13E)-6,10,14-trimethyl-1-phosphonohexadeca-5,9,13-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 100914126 |
| Molecular Formula | C19H35O6PS |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (5E,9E,13E)-6,10,14-trimethyl-1-phosphonohexadeca-5,9,13-triene-1-sulfonic acid |
| SMILES | CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCCC(P(=O)(O)O)S(=O)(=O)O |
| InChI | InChI=1S/C19H35O6PS/c1-5-16(2)11-8-12-18(4)14-9-13-17(3)10-6-7-15-19(26(20,21)22)27(23,24)25/h10-11,14,19H,5-9,12-13,15H2,1-4H3,(H2,20,21,22)(H,23,24,25)/b16-11+,17-10+,18-14+ |
| InChIKey | YIMPBNSVLQGLMR-HGAGMUQNSA-N |
| XLogP | 5.36 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|