C16H25O6PS — CID 19705908
(E)-6-methyl-8-(4-methylphenyl)-1-phosphonooct-5-ene-1-sulfonic acid (PubChem CID 19705908) has the molecular formula C16H25O6PS and a molecular weight of 376.41 g/mol. Its IUPAC name is (E)-6-methyl-8-(4-methylphenyl)-1-phosphonooct-5-ene-1-sulfonic acid.
| Compound Name | (E)-6-methyl-8-(4-methylphenyl)-1-phosphonooct-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 19705908 |
| Molecular Formula | C16H25O6PS |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (E)-6-methyl-8-(4-methylphenyl)-1-phosphonooct-5-ene-1-sulfonic acid |
| SMILES | C/C(=C\CCCC(P(=O)(O)O)S(=O)(=O)O)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C16H25O6PS/c1-13(7-10-15-11-8-14(2)9-12-15)5-3-4-6-16(23(17,18)19)24(20,21)22/h5,8-9,11-12,16H,3-4,6-7,10H2,1-2H3,(H2,17,18,19)(H,20,21,22)/b13-5+ |
| InChIKey | VXOHLDYLPUJNEP-WLRTZDKTSA-N |
| XLogP | 3.44 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|