C19H31O6PS — CID 54110486
6-methyl-1-phosphono-9-(4-propylphenyl)non-5-ene-1-sulfonic acid (PubChem CID 54110486) has the molecular formula C19H31O6PS and a molecular weight of 418.49 g/mol. Its IUPAC name is 6-methyl-1-phosphono-9-(4-propylphenyl)non-5-ene-1-sulfonic acid.
| Compound Name | 6-methyl-1-phosphono-9-(4-propylphenyl)non-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 54110486 |
| Molecular Formula | C19H31O6PS |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 6-methyl-1-phosphono-9-(4-propylphenyl)non-5-ene-1-sulfonic acid |
| SMILES | CCCc1ccc(CCCC(C)=CCCCC(P(=O)(O)O)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H31O6PS/c1-3-7-17-12-14-18(15-13-17)10-6-9-16(2)8-4-5-11-19(26(20,21)22)27(23,24)25/h8,12-15,19H,3-7,9-11H2,1-2H3,(H2,20,21,22)(H,23,24,25) |
| InChIKey | NGTAQNZOSKKQNQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|