C17H27O7PS — CID 19705773
(E)-6-methyl-1-phosphono-7-(4-propylphenoxy)hept-5-ene-1-sulfonic acid (PubChem CID 19705773) has the molecular formula C17H27O7PS and a molecular weight of 406.44 g/mol. Its IUPAC name is (E)-6-methyl-1-phosphono-7-(4-propylphenoxy)hept-5-ene-1-sulfonic acid.
| Compound Name | (E)-6-methyl-1-phosphono-7-(4-propylphenoxy)hept-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 19705773 |
| Molecular Formula | C17H27O7PS |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (E)-6-methyl-1-phosphono-7-(4-propylphenoxy)hept-5-ene-1-sulfonic acid |
| SMILES | CCCc1ccc(OC/C(C)=C/CCCC(P(=O)(O)O)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H27O7PS/c1-3-6-15-9-11-16(12-10-15)24-13-14(2)7-4-5-8-17(25(18,19)20)26(21,22)23/h7,9-12,17H,3-6,8,13H2,1-2H3,(H2,18,19,20)(H,21,22,23)/b14-7+ |
| InChIKey | UQSPSJBGEAUWCJ-VGOFMYFVSA-N |
| XLogP | 3.53 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|