C26H38N4O10 — CID 19169516
2,3-dihydroxybutanedioic acid;bis(2-(4-propylphenoxy)acetohydrazide) (PubChem CID 19169516) has the molecular formula C26H38N4O10 and a molecular weight of 566.61 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;bis(2-(4-propylphenoxy)acetohydrazide).
| Compound Name | 2,3-dihydroxybutanedioic acid;bis(2-(4-propylphenoxy)acetohydrazide) |
|---|---|
| PubChem CID | 19169516 |
| Molecular Formula | C26H38N4O10 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;bis(2-(4-propylphenoxy)acetohydrazide) |
| SMILES | CCCc1ccc(OCC(=O)NN)cc1.CCCc1ccc(OCC(=O)NN)cc1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/2C11H16N2O2.C4H6O6/c2*1-2-3-9-4-6-10(7-5-9)15-8-11(14)13-12;5-1(3(7)8)2(6)4(9)10/h2*4-7H,2-3,8,12H2,1H3,(H,13,14);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | QAGYYYQZSVAYPQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|