C22H28Cl2N4O10 — CID 19169518
bis(2-(4-chloro-3-methylphenoxy)acetohydrazide);2,3-dihydroxybutanedioic acid (PubChem CID 19169518) has the molecular formula C22H28Cl2N4O10 and a molecular weight of 579.39 g/mol. Its IUPAC name is bis(2-(4-chloro-3-methylphenoxy)acetohydrazide);2,3-dihydroxybutanedioic acid.
| Compound Name | bis(2-(4-chloro-3-methylphenoxy)acetohydrazide);2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 19169518 |
| Molecular Formula | C22H28Cl2N4O10 |
| Molecular Weight | 579.39 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | bis(2-(4-chloro-3-methylphenoxy)acetohydrazide);2,3-dihydroxybutanedioic acid |
| SMILES | Cc1cc(OCC(=O)NN)ccc1Cl.Cc1cc(OCC(=O)NN)ccc1Cl.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/2C9H11ClN2O2.C4H6O6/c2*1-6-4-7(2-3-8(6)10)14-5-9(13)12-11;5-1(3(7)8)2(6)4(9)10/h2*2-4H,5,11H2,1H3,(H,12,13);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | FNMWOVFMMQKMPV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|