C16H26NO6PS — CID 150915824
(E)-8-[2-(aminomethyl)phenyl]-6-methyl-1-phosphonooct-5-ene-1-sulfonic acid (PubChem CID 150915824) has the molecular formula C16H26NO6PS and a molecular weight of 391.43 g/mol. Its IUPAC name is (E)-8-[2-(aminomethyl)phenyl]-6-methyl-1-phosphonooct-5-ene-1-sulfonic acid.
| Compound Name | (E)-8-[2-(aminomethyl)phenyl]-6-methyl-1-phosphonooct-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 150915824 |
| Molecular Formula | C16H26NO6PS |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (E)-8-[2-(aminomethyl)phenyl]-6-methyl-1-phosphonooct-5-ene-1-sulfonic acid |
| SMILES | C/C(=C\CCCC(P(=O)(O)O)S(=O)(=O)O)CCc1ccccc1CN |
| InChI | InChI=1S/C16H26NO6PS/c1-13(10-11-14-7-3-4-8-15(14)12-17)6-2-5-9-16(24(18,19)20)25(21,22)23/h3-4,6-8,16H,2,5,9-12,17H2,1H3,(H2,18,19,20)(H,21,22,23)/b13-6+ |
| InChIKey | LCYZEXHAYKLLQC-AWNIVKPZSA-N |
| XLogP | 2.59 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|