C27H50O6P2 — CID 76837083
13-diethoxyphosphoryl-13-dimethoxyphosphoryl-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene (PubChem CID 76837083) has the molecular formula C27H50O6P2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 13-diethoxyphosphoryl-13-dimethoxyphosphoryl-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene.
| Compound Name | 13-diethoxyphosphoryl-13-dimethoxyphosphoryl-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene |
|---|---|
| PubChem CID | 76837083 |
| Molecular Formula | C27H50O6P2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 13-diethoxyphosphoryl-13-dimethoxyphosphoryl-2,6,10,16-tetramethylheptadeca-2,6,10,15-tetraene |
| SMILES | CCOP(=O)(OCC)C(CC=C(C)C)(CC=C(C)CCC=C(C)CCC=C(C)C)P(=O)(OC)OC |
| InChI | InChI=1S/C27H50O6P2/c1-11-32-35(29,33-12-2)27(21-19-24(5)6,34(28,30-9)31-10)22-20-26(8)18-14-17-25(7)16-13-15-23(3)4/h15,17,19-20H,11-14,16,18,21-22H2,1-10H3 |
| InChIKey | XGXDWWTYFALEJP-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|