C23H47O9P3 — CID 56651473
(6E)-9,9,9-tris(diethoxyphosphoryl)-2,6-dimethylnona-2,6-diene (PubChem CID 56651473) has the molecular formula C23H47O9P3 and a molecular weight of 560.54 g/mol. Its IUPAC name is (6E)-9,9,9-tris(diethoxyphosphoryl)-2,6-dimethylnona-2,6-diene.
| Compound Name | (6E)-9,9,9-tris(diethoxyphosphoryl)-2,6-dimethylnona-2,6-diene |
|---|---|
| PubChem CID | 56651473 |
| Molecular Formula | C23H47O9P3 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (6E)-9,9,9-tris(diethoxyphosphoryl)-2,6-dimethylnona-2,6-diene |
| SMILES | CCOP(=O)(OCC)C(C/C=C(\C)CCC=C(C)C)(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C23H47O9P3/c1-10-27-33(24,28-11-2)23(34(25,29-12-3)30-13-4,35(26,31-14-5)32-15-6)20-19-22(9)18-16-17-21(7)8/h17,19H,10-16,18,20H2,1-9H3/b22-19+ |
| InChIKey | MXWHQBAHXVXBHZ-ZBJSNUHESA-N |
| XLogP | 8.52 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|