C36H61O10PS — CID 10604896
(5E,9E)-1-[bis[(2-cyclohexylacetyl)oxymethoxy]phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid (PubChem CID 10604896) has the molecular formula C36H61O10PS and a molecular weight of 716.92 g/mol. Its IUPAC name is (5E,9E)-1-[bis[(2-cyclohexylacetyl)oxymethoxy]phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid.
| Compound Name | (5E,9E)-1-[bis[(2-cyclohexylacetyl)oxymethoxy]phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 10604896 |
| Molecular Formula | C36H61O10PS |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.37 |
| IUPAC Name | (5E,9E)-1-[bis[(2-cyclohexylacetyl)oxymethoxy]phosphoryl]-6,10,14-trimethylpentadeca-5,9,13-triene-1-sulfonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCC(P(=O)(OCOC(=O)CC1CCCCC1)OCOC(=O)CC1CCCCC1)S(=O)(=O)O |
| InChI | InChI=1S/C36H61O10PS/c1-29(2)15-13-17-31(4)19-14-18-30(3)16-11-12-24-36(48(40,41)42)47(39,45-27-43-34(37)25-32-20-7-5-8-21-32)46-28-44-35(38)26-33-22-9-6-10-23-33/h15-16,19,32-33,36H,5-14,17-18,20-28H2,1-4H3,(H,40,41,42)/b30-16+,31-19+ |
| InChIKey | NQHMNQZKBHOTPB-XDZUUXCHSA-N |
| XLogP | 9.96 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|