C18H32 — CID 123487662
7,9,12-trimethylpentadeca-4,6,8-triene (PubChem CID 123487662) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is 7,9,12-trimethylpentadeca-4,6,8-triene.
| Compound Name | 7,9,12-trimethylpentadeca-4,6,8-triene |
|---|---|
| PubChem CID | 123487662 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 7,9,12-trimethylpentadeca-4,6,8-triene |
| SMILES | CCCC=CC=C(C)C=C(C)CCC(C)CCC |
| InChI | InChI=1S/C18H32/c1-6-8-9-10-12-17(4)15-18(5)14-13-16(3)11-7-2/h9-10,12,15-16H,6-8,11,13-14H2,1-5H3 |
| InChIKey | SYSUNLGIJQDSBH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|