C14H25N — CID 143649845
(4E,6E,8E)-9-methyltrideca-4,6,8-trien-7-amine (PubChem CID 143649845) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (4E,6E,8E)-9-methyltrideca-4,6,8-trien-7-amine.
| Compound Name | (4E,6E,8E)-9-methyltrideca-4,6,8-trien-7-amine |
|---|---|
| PubChem CID | 143649845 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (4E,6E,8E)-9-methyltrideca-4,6,8-trien-7-amine |
| SMILES | CCC/C=C/C=C(N)\C=C(/C)CCCC |
| InChI | InChI=1S/C14H25N/c1-4-6-8-9-11-14(15)12-13(3)10-7-5-2/h8-9,11-12H,4-7,10,15H2,1-3H3/b9-8+,13-12+,14-11+ |
| InChIKey | DJYHZGVBVVNDNU-YCOAFFKSSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|