C7H8Cl2 — CID 88535006
(1E,3Z,5E)-1,6-dichloro-3-methylhexa-1,3,5-triene (PubChem CID 88535006) has the molecular formula C7H8Cl2 and a molecular weight of 163.05 g/mol. Its IUPAC name is (1E,3Z,5E)-1,6-dichloro-3-methylhexa-1,3,5-triene.
| Compound Name | (1E,3Z,5E)-1,6-dichloro-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 88535006 |
| Molecular Formula | C7H8Cl2 |
| Molecular Weight | 163.05 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | (1E,3Z,5E)-1,6-dichloro-3-methylhexa-1,3,5-triene |
| SMILES | CC(=C/C=C/Cl)/C=C/Cl |
| InChI | InChI=1S/C7H8Cl2/c1-7(4-6-9)3-2-5-8/h2-6H,1H3/b5-2+,6-4+,7-3- |
| InChIKey | QLBAYVDDCBVJRO-ZPVSMGMDSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.05 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|