C6H9ClS — CID 142924805
(3Z,5E)-6-chlorohexa-3,5-diene-3-thiol (PubChem CID 142924805) has the molecular formula C6H9ClS and a molecular weight of 148.66 g/mol. Its IUPAC name is (3Z,5E)-6-chlorohexa-3,5-diene-3-thiol.
| Compound Name | (3Z,5E)-6-chlorohexa-3,5-diene-3-thiol |
|---|---|
| PubChem CID | 142924805 |
| Molecular Formula | C6H9ClS |
| Molecular Weight | 148.66 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | (3Z,5E)-6-chlorohexa-3,5-diene-3-thiol |
| SMILES | CC/C(S)=C/C=C/Cl |
| InChI | InChI=1S/C6H9ClS/c1-2-6(8)4-3-5-7/h3-5,8H,2H2,1H3/b5-3+,6-4- |
| InChIKey | XMURXWMQXBLLPV-UZNMPDEFSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|