C20H26O2 — CID 102040376
(1Z,3E,5E,7E,9E,11E,13E,15Z)-2,6,11,15-tetramethylhexadeca-1,3,5,7,9,11,13,15-octaene-1,16-diol (PubChem CID 102040376) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (1Z,3E,5E,7E,9E,11E,13E,15Z)-2,6,11,15-tetramethylhexadeca-1,3,5,7,9,11,13,15-octaene-1,16-diol.
| Compound Name | (1Z,3E,5E,7E,9E,11E,13E,15Z)-2,6,11,15-tetramethylhexadeca-1,3,5,7,9,11,13,15-octaene-1,16-diol |
|---|---|
| PubChem CID | 102040376 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1Z,3E,5E,7E,9E,11E,13E,15Z)-2,6,11,15-tetramethylhexadeca-1,3,5,7,9,11,13,15-octaene-1,16-diol |
| SMILES | CC(=C/O)/C=C/C=C(C)/C=C/C=C/C(C)=C/C=C/C(C)=C\O |
| InChI | InChI=1S/C20H26O2/c1-17(11-7-13-19(3)15-21)9-5-6-10-18(2)12-8-14-20(4)16-22/h5-16,21-22H,1-4H3/b9-5+,10-6+,13-7+,14-8+,17-11+,18-12+,19-15-,20-16- |
| InChIKey | KHLSSHQBPAAWCD-UXMATVHHSA-N |
| XLogP | 6.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|