C9H12O2 — CID 59954083
(6Z)-7-hydroxy-4,6-dimethylhepta-2,4,6-trienal (PubChem CID 59954083) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (6Z)-7-hydroxy-4,6-dimethylhepta-2,4,6-trienal.
| Compound Name | (6Z)-7-hydroxy-4,6-dimethylhepta-2,4,6-trienal |
|---|---|
| PubChem CID | 59954083 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (6Z)-7-hydroxy-4,6-dimethylhepta-2,4,6-trienal |
| SMILES | CC(C=CC=O)=C/C(C)=C\O |
| InChI | InChI=1S/C9H12O2/c1-8(4-3-5-10)6-9(2)7-11/h3-7,11H,1-2H3/b4-3?,8-6?,9-7- |
| InChIKey | VZIODYVUWZYMQT-ZSOQUJRSSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|