C11H16O — CID 123537453
5-cyclopentyl-4-methylpenta-2,4-dienal (PubChem CID 123537453) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-cyclopentyl-4-methylpenta-2,4-dienal.
| Compound Name | 5-cyclopentyl-4-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 123537453 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 5-cyclopentyl-4-methylpenta-2,4-dienal |
| SMILES | CC(C=CC=O)=CC1CCCC1 |
| InChI | InChI=1S/C11H16O/c1-10(5-4-8-12)9-11-6-2-3-7-11/h4-5,8-9,11H,2-3,6-7H2,1H3 |
| InChIKey | DLNAPZUJWSAPAF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|