About cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal)
cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) (PubChem CID 134980870) has the molecular formula C8H12CoO4
and a molecular weight of 231.11 g/mol. Its IUPAC name is cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal).
Molecular Properties
| Compound Name | cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) |
| PubChem CID | 134980870 |
| Molecular Formula | C8H12CoO4 |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) |
| SMILES | C/C(C=O)=C/O.C/C(C=O)=C/O.[Co] |
| InChI | InChI=1S/2C4H6O2.Co/c2*1-4(2-5)3-6;/h2*2-3,5H,1H3;/b2*4-2-; |
| InChIKey | FSYXXPJETRUHHR-BGHCZBHZSA-N |
| XLogP | 1.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal)?
The IUPAC name of cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) (CID 134980870) is cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal).
What is the SMILES notation for cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal)?
The canonical SMILES for cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) is C/C(C=O)=C/O.C/C(C=O)=C/O.[Co].
What is the InChIKey of cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal)?
The InChIKey is FSYXXPJETRUHHR-BGHCZBHZSA-N. The full InChI is InChI=1S/2C4H6O2.Co/c2*1-4(2-5)3-6;/h2*2-3,5H,1H3;/b2*4-2-;.
What are the key properties of cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal)?
cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) has a molecular weight of 231.11 g/mol, XLogP of 1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis((Z)-3-hydroxy-2-methylprop-2-enal) is sourced from PubChem (CID 134980870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).