C9H12O — CID 24977703
(2E,4E,6E)-3-methylocta-2,4,6-trienal (PubChem CID 24977703) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (2E,4E,6E)-3-methylocta-2,4,6-trienal.
| Compound Name | (2E,4E,6E)-3-methylocta-2,4,6-trienal |
|---|---|
| PubChem CID | 24977703 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (2E,4E,6E)-3-methylocta-2,4,6-trienal |
| SMILES | C/C=C/C=C/C(C)=C/C=O |
| InChI | InChI=1S/C9H12O/c1-3-4-5-6-9(2)7-8-10/h3-8H,1-2H3/b4-3+,6-5+,9-7+ |
| InChIKey | YXYKZFROJWBWHB-DTPQUVBVSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|