C10H15N3O — CID 3312276
(3-methylocta-2,4,6-trienylideneamino)urea (PubChem CID 3312276) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is (3-methylocta-2,4,6-trienylideneamino)urea.
| Compound Name | (3-methylocta-2,4,6-trienylideneamino)urea |
|---|---|
| PubChem CID | 3312276 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (3-methylocta-2,4,6-trienylideneamino)urea |
| SMILES | CC=CC=CC(C)=CC=NNC(N)=O |
| InChI | InChI=1S/C10H15N3O/c1-3-4-5-6-9(2)7-8-12-13-10(11)14/h3-8H,1-2H3,(H3,11,13,14) |
| InChIKey | AJRMWWVTHFOWGT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|