C20H32O — CID 144550356
(1E,3Z,5E,7E)-8-(2,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraen-1-ol;ethane (PubChem CID 144550356) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1E,3Z,5E,7E)-8-(2,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraen-1-ol;ethane.
| Compound Name | (1E,3Z,5E,7E)-8-(2,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraen-1-ol;ethane |
|---|---|
| PubChem CID | 144550356 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1E,3Z,5E,7E)-8-(2,6-dimethylcyclohexen-1-yl)-2,6-dimethylocta-1,3,5,7-tetraen-1-ol;ethane |
| SMILES | CC.CC1=C(/C=C/C(C)=C/C=C\C(C)=C\O)C(C)CCC1 |
| InChI | InChI=1S/C18H26O.C2H6/c1-14(7-5-8-15(2)13-19)11-12-18-16(3)9-6-10-17(18)4;1-2/h5,7-8,11-13,16,19H,6,9-10H2,1-4H3;1-2H3/b8-5-,12-11+,14-7+,15-13+; |
| InChIKey | HYWBYYMJYRYXQQ-DEMPBENZSA-N |
| XLogP | 6.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|