C20H30O — CID 143095124
2-[(1E,3E,5E,7E)-9-methoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethylcyclohexene (PubChem CID 143095124) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-9-methoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-9-methoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 143095124 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-9-methoxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethylcyclohexene |
| SMILES | COC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1C |
| InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)14-15-21-5)12-13-20-18(3)10-7-11-19(20)4/h6,8-9,12-14,18H,7,10-11,15H2,1-5H3/b9-6+,13-12+,16-8+,17-14+ |
| InChIKey | INILDBXMUKVDOL-XDLGABRLSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|