C25H38O2 — CID 14991239
2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxane (PubChem CID 14991239) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxane.
| Compound Name | 2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxane |
|---|---|
| PubChem CID | 14991239 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]oxane |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC2CCCCO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C25H38O2/c1-20(14-15-23-22(3)12-9-17-25(23,4)5)10-8-11-21(2)16-19-27-24-13-6-7-18-26-24/h8,10-11,14-16,24H,6-7,9,12-13,17-19H2,1-5H3/b11-8+,15-14+,20-10+,21-16+ |
| InChIKey | CSAYICRUTOQJSU-DDCWBELGSA-N |
| XLogP | 7.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|