C28H43NO3 — CID 173434345
(2E,4E,6E,8E)-3,7-dimethyl-N-[2-(oxan-2-yloxy)propyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 173434345) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-N-[2-(oxan-2-yloxy)propyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-N-[2-(oxan-2-yloxy)propyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 173434345 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-N-[2-(oxan-2-yloxy)propyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NCC(C)OC2CCCCO2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H43NO3/c1-21(15-16-25-23(3)13-10-17-28(25,5)6)11-9-12-22(2)19-26(30)29-20-24(4)32-27-14-7-8-18-31-27/h9,11-12,15-16,19,24,27H,7-8,10,13-14,17-18,20H2,1-6H3,(H,29,30)/b12-9+,16-15+,21-11+,22-19+ |
| InChIKey | VQWIOPKRSACOCV-PIGFBOIVSA-N |
| XLogP | 6.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|