C24H37NO3 — CID 165359164
N-[2-(2-hydroxyethoxy)ethyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 165359164) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 165359164 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)NCCOCCO |
| InChI | InChI=1S/C24H37NO3/c1-19(11-12-22-21(3)10-7-13-24(22,4)5)8-6-9-20(2)18-23(27)25-14-16-28-17-15-26/h6,8-9,11-12,18,26H,7,10,13-17H2,1-5H3,(H,25,27) |
| InChIKey | JGBJGVMZJKNERX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|