C31H49N3O5 — CID 59841692
6-amino-2-[3-[2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy]propanoylamino]hexanoic acid (PubChem CID 59841692) has the molecular formula C31H49N3O5 and a molecular weight of 543.75 g/mol. Its IUPAC name is 6-amino-2-[3-[2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[3-[2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 59841692 |
| Molecular Formula | C31H49N3O5 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.37 |
| IUPAC Name | 6-amino-2-[3-[2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]ethoxy]propanoylamino]hexanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NCCOCCC(=O)NC(CCCCN)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C31H49N3O5/c1-23(14-15-26-25(3)12-9-17-31(26,4)5)10-8-11-24(2)22-29(36)33-19-21-39-20-16-28(35)34-27(30(37)38)13-6-7-18-32/h8,10-11,14-15,22,27H,6-7,9,12-13,16-21,32H2,1-5H3,(H,33,36)(H,34,35)(H,37,38)/b11-8+,15-14+,23-10+,24-22+ |
| InChIKey | FICYVLKWWLPDKC-VMPWLMOWSA-N |
| XLogP | 4.74 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|