C23H33NO3 — CID 74932355
3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoic acid (PubChem CID 74932355) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoic acid.
| Compound Name | 3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 74932355 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)NCCC(=O)O |
| InChI | InChI=1S/C23H33NO3/c1-17(11-12-20-19(3)10-7-14-23(20,4)5)8-6-9-18(2)16-21(25)24-15-13-22(26)27/h6,8-9,11-12,16H,7,10,13-15H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | NBUQUJTWRSGUMQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|