C22H32O — CID 143095132
(5E,7E,9E,11E)-12-(2,6-dimethylcyclohexen-1-yl)-6,10-dimethyldodeca-5,7,9,11-tetraen-2-one (PubChem CID 143095132) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is (5E,7E,9E,11E)-12-(2,6-dimethylcyclohexen-1-yl)-6,10-dimethyldodeca-5,7,9,11-tetraen-2-one.
| Compound Name | (5E,7E,9E,11E)-12-(2,6-dimethylcyclohexen-1-yl)-6,10-dimethyldodeca-5,7,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 143095132 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (5E,7E,9E,11E)-12-(2,6-dimethylcyclohexen-1-yl)-6,10-dimethyldodeca-5,7,9,11-tetraen-2-one |
| SMILES | CC(=O)CC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1C |
| InChI | InChI=1S/C22H32O/c1-17(11-7-14-21(5)23)9-6-10-18(2)15-16-22-19(3)12-8-13-20(22)4/h6,9-11,15-16,19H,7-8,12-14H2,1-5H3/b9-6+,16-15+,17-11+,18-10+ |
| InChIKey | BJNAMWNMNXOZEY-HWEQEQJXSA-N |
| XLogP | 6.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|