C19H29N — CID 143520371
(2Z,4E,6E,8E)-9-(2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-amine (PubChem CID 143520371) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (2Z,4E,6E,8E)-9-(2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2Z,4E,6E,8E)-9-(2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 143520371 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (2Z,4E,6E,8E)-9-(2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraen-1-amine |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C\CN)C(C)CCC1 |
| InChI | InChI=1S/C19H29N/c1-15(7-5-8-16(2)13-14-20)11-12-19-17(3)9-6-10-18(19)4/h5,7-8,11-13,17H,6,9-10,14,20H2,1-4H3/b8-5+,12-11+,15-7+,16-13- |
| InChIKey | VNXIYCWQFUULGF-KJDHFLNFSA-N |
| XLogP | 5.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|