C30H48O — CID 143095107
(13E,15E,17E,19E)-20-(2,6-dimethylcyclohexen-1-yl)-14,18-dimethylicosa-13,15,17,19-tetraen-10-one (PubChem CID 143095107) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is (13E,15E,17E,19E)-20-(2,6-dimethylcyclohexen-1-yl)-14,18-dimethylicosa-13,15,17,19-tetraen-10-one.
| Compound Name | (13E,15E,17E,19E)-20-(2,6-dimethylcyclohexen-1-yl)-14,18-dimethylicosa-13,15,17,19-tetraen-10-one |
|---|---|
| PubChem CID | 143095107 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | (13E,15E,17E,19E)-20-(2,6-dimethylcyclohexen-1-yl)-14,18-dimethylicosa-13,15,17,19-tetraen-10-one |
| SMILES | CCCCCCCCCC(=O)CC/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1C |
| InChI | InChI=1S/C30H48O/c1-6-7-8-9-10-11-12-21-29(31)22-14-18-25(2)16-13-17-26(3)23-24-30-27(4)19-15-20-28(30)5/h13,16-18,23-24,27H,6-12,14-15,19-22H2,1-5H3/b16-13+,24-23+,25-18+,26-17+ |
| InChIKey | LYLDBDQRDUWASE-NNUKRWQXSA-N |
| XLogP | 9.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|