C18H26 — CID 170619792
1,3-dimethyl-2-[(4Z)-7-methyl-3-methylideneocta-1,4,6-trien-2-yl]cyclohexene (PubChem CID 170619792) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1,3-dimethyl-2-[(4Z)-7-methyl-3-methylideneocta-1,4,6-trien-2-yl]cyclohexene.
| Compound Name | 1,3-dimethyl-2-[(4Z)-7-methyl-3-methylideneocta-1,4,6-trien-2-yl]cyclohexene |
|---|---|
| PubChem CID | 170619792 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1,3-dimethyl-2-[(4Z)-7-methyl-3-methylideneocta-1,4,6-trien-2-yl]cyclohexene |
| SMILES | C=C(/C=C\C=C(C)C)C(=C)C1=C(C)CCCC1C |
| InChI | InChI=1S/C18H26/c1-13(2)9-7-10-14(3)17(6)18-15(4)11-8-12-16(18)5/h7,9-10,15H,3,6,8,11-12H2,1-2,4-5H3/b10-7- |
| InChIKey | BZGMNLAEMQXPLI-YFHOEESVSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|