C17H33N — CID 143063433
N-(2,6-dimethylcyclohexen-1-yl)-3-methylbut-3-en-2-imine;ethane (PubChem CID 143063433) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexen-1-yl)-3-methylbut-3-en-2-imine;ethane.
| Compound Name | N-(2,6-dimethylcyclohexen-1-yl)-3-methylbut-3-en-2-imine;ethane |
|---|---|
| PubChem CID | 143063433 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | N-(2,6-dimethylcyclohexen-1-yl)-3-methylbut-3-en-2-imine;ethane |
| SMILES | C=C(C)/C(C)=N/C1=C(C)CCCC1C.CC.CC |
| InChI | InChI=1S/C13H21N.2C2H6/c1-9(2)12(5)14-13-10(3)7-6-8-11(13)4;2*1-2/h10H,1,6-8H2,2-5H3;2*1-2H3/b14-12+;; |
| InChIKey | HBZUDYGWDGEULO-QHXCTMFKSA-N |
| XLogP | 6.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|