C11H18 — CID 170619549
(3S)-2,3-dimethyl-1-prop-1-en-2-ylcyclohexene (PubChem CID 170619549) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (3S)-2,3-dimethyl-1-prop-1-en-2-ylcyclohexene.
| Compound Name | (3S)-2,3-dimethyl-1-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 170619549 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (3S)-2,3-dimethyl-1-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)C1=C(C)[C@@H](C)CCC1 |
| InChI | InChI=1S/C11H18/c1-8(2)11-7-5-6-9(3)10(11)4/h9H,1,5-7H2,2-4H3/t9-/m0/s1 |
| InChIKey | PFEFJGIIKZLQGH-VIFPVBQESA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |