About 3-methylcyclohexene-1,2-dicarbonyl chloride
3-methylcyclohexene-1,2-dicarbonyl chloride (PubChem CID 142725909) has the molecular formula C9H10Cl2O2
and a molecular weight of 221.08 g/mol. Its IUPAC name is 3-methylcyclohexene-1,2-dicarbonyl chloride.
Molecular Properties
| Compound Name | 3-methylcyclohexene-1,2-dicarbonyl chloride |
| PubChem CID | 142725909 |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 3-methylcyclohexene-1,2-dicarbonyl chloride |
| SMILES | CC1CCCC(C(=O)Cl)=C1C(=O)Cl |
| InChI | InChI=1S/C9H10Cl2O2/c1-5-3-2-4-6(8(10)12)7(5)9(11)13/h5H,2-4H2,1H3 |
| InChIKey | ULDGWHWAXIAXPE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylcyclohexene-1,2-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclohexene-1,2-dicarbonyl chloride?
The IUPAC name of 3-methylcyclohexene-1,2-dicarbonyl chloride (CID 142725909) is 3-methylcyclohexene-1,2-dicarbonyl chloride.
What is the SMILES notation for 3-methylcyclohexene-1,2-dicarbonyl chloride?
The canonical SMILES for 3-methylcyclohexene-1,2-dicarbonyl chloride is CC1CCCC(C(=O)Cl)=C1C(=O)Cl.
What is the InChIKey of 3-methylcyclohexene-1,2-dicarbonyl chloride?
The InChIKey is ULDGWHWAXIAXPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2O2/c1-5-3-2-4-6(8(10)12)7(5)9(11)13/h5H,2-4H2,1H3.
What are the key properties of 3-methylcyclohexene-1,2-dicarbonyl chloride?
3-methylcyclohexene-1,2-dicarbonyl chloride has a molecular weight of 221.08 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclohexene-1,2-dicarbonyl chloride is sourced from PubChem (CID 142725909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).