C15H16ClNO3 — CID 70360300
2-[(4-chlorophenyl)carbamoyl]-6-methylcyclohexene-1-carboxylic acid (PubChem CID 70360300) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoyl]-6-methylcyclohexene-1-carboxylic acid.
| Compound Name | 2-[(4-chlorophenyl)carbamoyl]-6-methylcyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 70360300 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoyl]-6-methylcyclohexene-1-carboxylic acid |
| SMILES | CC1CCCC(C(=O)Nc2ccc(Cl)cc2)=C1C(=O)O |
| InChI | InChI=1S/C15H16ClNO3/c1-9-3-2-4-12(13(9)15(19)20)14(18)17-11-7-5-10(16)6-8-11/h5-9H,2-4H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | YWUAHFVQPXVSLP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |