C19H16ClNO3 — CID 21084805
2-[[3-(4-chlorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 21084805) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid.
| Compound Name | 2-[[3-(4-chlorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 21084805 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)Nc2cccc(-c3ccc(Cl)cc3)c2)CCC1 |
| InChI | InChI=1S/C19H16ClNO3/c20-14-9-7-12(8-10-14)13-3-1-4-15(11-13)21-18(22)16-5-2-6-17(16)19(23)24/h1,3-4,7-11H,2,5-6H2,(H,21,22)(H,23,24) |
| InChIKey | WOIDMUGHAVWMAJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |