C20H18FNO3S — CID 21084761
2-[[2-fluoro-4-(4-methylsulfanylphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 21084761) has the molecular formula C20H18FNO3S and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(4-methylsulfanylphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid.
| Compound Name | 2-[[2-fluoro-4-(4-methylsulfanylphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 21084761 |
| Molecular Formula | C20H18FNO3S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-[[2-fluoro-4-(4-methylsulfanylphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | CSc1ccc(-c2ccc(NC(=O)C3=C(C(=O)O)CCC3)c(F)c2)cc1 |
| InChI | InChI=1S/C20H18FNO3S/c1-26-14-8-5-12(6-9-14)13-7-10-18(17(21)11-13)22-19(23)15-3-2-4-16(15)20(24)25/h5-11H,2-4H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | OMPKAEOIXRKNGR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |