C21H37IO2 — CID 142558049
[7-(2,3-dimethylcyclohexen-1-yl)-3-methyl-5-methylidene-7-oxoheptyl] hypoiodite;ethane;ethene (PubChem CID 142558049) has the molecular formula C21H37IO2 and a molecular weight of 448.43 g/mol. Its IUPAC name is [7-(2,3-dimethylcyclohexen-1-yl)-3-methyl-5-methylidene-7-oxoheptyl] hypoiodite;ethane;ethene.
| Compound Name | [7-(2,3-dimethylcyclohexen-1-yl)-3-methyl-5-methylidene-7-oxoheptyl] hypoiodite;ethane;ethene |
|---|---|
| PubChem CID | 142558049 |
| Molecular Formula | C21H37IO2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [7-(2,3-dimethylcyclohexen-1-yl)-3-methyl-5-methylidene-7-oxoheptyl] hypoiodite;ethane;ethene |
| SMILES | C=C.C=C(CC(=O)C1=C(C)C(C)CCC1)CC(C)CCOI.CC |
| InChI | InChI=1S/C17H27IO2.C2H6.C2H4/c1-12(8-9-20-18)10-13(2)11-17(19)16-7-5-6-14(3)15(16)4;2*1-2/h12,14H,2,5-11H2,1,3-4H3;1-2H3;1-2H2 |
| InChIKey | OVVDHJWWLFGZOI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|