C14H25NO4S — CID 102253606
ethyl 2-(tert-butylsulfonylamino)-3-methylcyclohexene-1-carboxylate (PubChem CID 102253606) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is ethyl 2-(tert-butylsulfonylamino)-3-methylcyclohexene-1-carboxylate.
| Compound Name | ethyl 2-(tert-butylsulfonylamino)-3-methylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102253606 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl 2-(tert-butylsulfonylamino)-3-methylcyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(NS(=O)(=O)C(C)(C)C)C(C)CCC1 |
| InChI | InChI=1S/C14H25NO4S/c1-6-19-13(16)11-9-7-8-10(2)12(11)15-20(17,18)14(3,4)5/h10,15H,6-9H2,1-5H3 |
| InChIKey | WRSMDWLCSYQVAB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |