C17H19Cl2NO3 — CID 134124647
ethyl 2-[(2,6-dichlorophenyl)methylcarbamoyl]cyclohexene-1-carboxylate (PubChem CID 134124647) has the molecular formula C17H19Cl2NO3 and a molecular weight of 356.25 g/mol. Its IUPAC name is ethyl 2-[(2,6-dichlorophenyl)methylcarbamoyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 2-[(2,6-dichlorophenyl)methylcarbamoyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 134124647 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | ethyl 2-[(2,6-dichlorophenyl)methylcarbamoyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)NCc2c(Cl)cccc2Cl)CCCC1 |
| InChI | InChI=1S/C17H19Cl2NO3/c1-2-23-17(22)12-7-4-3-6-11(12)16(21)20-10-13-14(18)8-5-9-15(13)19/h5,8-9H,2-4,6-7,10H2,1H3,(H,20,21) |
| InChIKey | QMLGVKKNAFJBFV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |