C23H24ClNO3 — CID 118562101
methyl 4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoate (PubChem CID 118562101) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is methyl 4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 118562101 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)C2=C(Cc3ccccc3Cl)CCCC2)cc1 |
| InChI | InChI=1S/C23H24ClNO3/c1-28-23(27)17-12-10-16(11-13-17)15-25-22(26)20-8-4-2-6-18(20)14-19-7-3-5-9-21(19)24/h3,5,7,9-13H,2,4,6,8,14-15H2,1H3,(H,25,26) |
| InChIKey | YZTYJLWYJKZTSK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |