C22H22ClNO3 — CID 118562065
4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoic acid (PubChem CID 118562065) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 118562065 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-[[[2-[(2-chlorophenyl)methyl]cyclohexene-1-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)cc1)C1=C(Cc2ccccc2Cl)CCCC1 |
| InChI | InChI=1S/C22H22ClNO3/c23-20-8-4-2-6-18(20)13-17-5-1-3-7-19(17)21(25)24-14-15-9-11-16(12-10-15)22(26)27/h2,4,6,8-12H,1,3,5,7,13-14H2,(H,24,25)(H,26,27) |
| InChIKey | QXYGHQHABPHVTN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |