C14H10Cl2N2O3 — CID 103602653
4-[[(3,6-dichloropyridine-2-carbonyl)amino]methyl]benzoic acid (PubChem CID 103602653) has the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is 4-[[(3,6-dichloropyridine-2-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(3,6-dichloropyridine-2-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 103602653 |
| Molecular Formula | C14H10Cl2N2O3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-[[(3,6-dichloropyridine-2-carbonyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2nc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2N2O3/c15-10-5-6-11(16)18-12(10)13(19)17-7-8-1-3-9(4-2-8)14(20)21/h1-6H,7H2,(H,17,19)(H,20,21) |
| InChIKey | VPKZXNVMCNRMKW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|