C8H8Cl2N2O2 — CID 60692450
3,6-dichloro-N-(2-hydroxyethyl)pyridine-2-carboxamide (PubChem CID 60692450) has the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-hydroxyethyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(2-hydroxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60692450 |
| Molecular Formula | C8H8Cl2N2O2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 3,6-dichloro-N-(2-hydroxyethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCO)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H8Cl2N2O2/c9-5-1-2-6(10)12-7(5)8(14)11-3-4-13/h1-2,13H,3-4H2,(H,11,14) |
| InChIKey | IXZRPBTULSZEEM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|