C10H12Cl2N2O — CID 66568204
(2S)-2-amino-N-[(2,6-dichlorophenyl)methyl]propanamide (PubChem CID 66568204) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2,6-dichlorophenyl)methyl]propanamide.
| Compound Name | (2S)-2-amino-N-[(2,6-dichlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 66568204 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (2S)-2-amino-N-[(2,6-dichlorophenyl)methyl]propanamide |
| SMILES | C[C@H](N)C(=O)NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-6(13)10(15)14-5-7-8(11)3-2-4-9(7)12/h2-4,6H,5,13H2,1H3,(H,14,15)/t6-/m0/s1 |
| InChIKey | SPZQNFUOKDYFBQ-LURJTMIESA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |